C17H31FN2O2 — CID 168882699
ethane;1-[1-(1-ethylpiperidine-4-carbonyl)-4-fluoropiperidin-4-yl]ethanone (PubChem CID 168882699) has the molecular formula C17H31FN2O2 and a molecular weight of 314.44 g/mol. Its IUPAC name is ethane;1-[1-(1-ethylpiperidine-4-carbonyl)-4-fluoropiperidin-4-yl]ethanone.
| Compound Name | ethane;1-[1-(1-ethylpiperidine-4-carbonyl)-4-fluoropiperidin-4-yl]ethanone |
|---|---|
| PubChem CID | 168882699 |
| Molecular Formula | C17H31FN2O2 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | ethane;1-[1-(1-ethylpiperidine-4-carbonyl)-4-fluoropiperidin-4-yl]ethanone |
| SMILES | CC.CCN1CCC(C(=O)N2CCC(F)(C(C)=O)CC2)CC1 |
| InChI | InChI=1S/C15H25FN2O2.C2H6/c1-3-17-8-4-13(5-9-17)14(20)18-10-6-15(16,7-11-18)12(2)19;1-2/h13H,3-11H2,1-2H3;1-2H3 |
| InChIKey | MPWMTSJKSARHDE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |