About methanamine;4-[1-[4-methoxy-2-(methylamino)phenyl]propylideneamino]benzenethiol
methanamine;4-[1-[4-methoxy-2-(methylamino)phenyl]propylideneamino]benzenethiol (PubChem CID 168886701) has the molecular formula C18H25N3OS
and a molecular weight of 331.49 g/mol. Its IUPAC name is methanamine;4-[1-[4-methoxy-2-(methylamino)phenyl]propylideneamino]benzenethiol.
Molecular Properties
| Compound Name | methanamine;4-[1-[4-methoxy-2-(methylamino)phenyl]propylideneamino]benzenethiol |
| PubChem CID | 168886701 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | methanamine;4-[1-[4-methoxy-2-(methylamino)phenyl]propylideneamino]benzenethiol |
| SMILES | CC/C(=N\c1ccc(S)cc1)c1ccc(OC)cc1NC.CN |
| InChI | InChI=1S/C17H20N2OS.CH5N/c1-4-16(19-12-5-8-14(21)9-6-12)15-10-7-13(20-3)11-17(15)18-2;1-2/h5-11,18,21H,4H2,1-3H3;2H2,1H3/b19-16+; |
| InChIKey | MCURKXIAPRBYAY-PXMDEAMVSA-N |
| XLogP | 4.13 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methanamine;4-[1-[4-methoxy-2-(methylamino)phenyl]propylideneamino]benzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;4-[1-[4-methoxy-2-(methylamino)phenyl]propylideneamino]benzenethiol?
The IUPAC name of methanamine;4-[1-[4-methoxy-2-(methylamino)phenyl]propylideneamino]benzenethiol (CID 168886701) is methanamine;4-[1-[4-methoxy-2-(methylamino)phenyl]propylideneamino]benzenethiol.
What is the SMILES notation for methanamine;4-[1-[4-methoxy-2-(methylamino)phenyl]propylideneamino]benzenethiol?
The canonical SMILES for methanamine;4-[1-[4-methoxy-2-(methylamino)phenyl]propylideneamino]benzenethiol is CC/C(=N\c1ccc(S)cc1)c1ccc(OC)cc1NC.CN.
What is the InChIKey of methanamine;4-[1-[4-methoxy-2-(methylamino)phenyl]propylideneamino]benzenethiol?
The InChIKey is MCURKXIAPRBYAY-PXMDEAMVSA-N. The full InChI is InChI=1S/C17H20N2OS.CH5N/c1-4-16(19-12-5-8-14(21)9-6-12)15-10-7-13(20-3)11-17(15)18-2;1-2/h5-11,18,21H,4H2,1-3H3;2H2,1H3/b19-16+;.
What are the key properties of methanamine;4-[1-[4-methoxy-2-(methylamino)phenyl]propylideneamino]benzenethiol?
methanamine;4-[1-[4-methoxy-2-(methylamino)phenyl]propylideneamino]benzenethiol has a molecular weight of 331.49 g/mol, XLogP of 4.13, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;4-[1-[4-methoxy-2-(methylamino)phenyl]propylideneamino]benzenethiol is sourced from PubChem (CID 168886701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).