About 1-cyclopropylpyrazole;1-methoxypentane
1-cyclopropylpyrazole;1-methoxypentane (PubChem CID 168887617) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is 1-cyclopropylpyrazole;1-methoxypentane.
Molecular Properties
| Compound Name | 1-cyclopropylpyrazole;1-methoxypentane |
| PubChem CID | 168887617 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 1-cyclopropylpyrazole;1-methoxypentane |
| SMILES | CCCCCOC.c1cnn(C2CC2)c1 |
| InChI | InChI=1S/C6H8N2.C6H14O/c1-4-7-8(5-1)6-2-3-6;1-3-4-5-6-7-2/h1,4-6H,2-3H2;3-6H2,1-2H3 |
| InChIKey | QFLXZVRTKIAJPV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopropylpyrazole;1-methoxypentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropylpyrazole;1-methoxypentane?
The IUPAC name of 1-cyclopropylpyrazole;1-methoxypentane (CID 168887617) is 1-cyclopropylpyrazole;1-methoxypentane.
What is the SMILES notation for 1-cyclopropylpyrazole;1-methoxypentane?
The canonical SMILES for 1-cyclopropylpyrazole;1-methoxypentane is CCCCCOC.c1cnn(C2CC2)c1.
What is the InChIKey of 1-cyclopropylpyrazole;1-methoxypentane?
The InChIKey is QFLXZVRTKIAJPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.C6H14O/c1-4-7-8(5-1)6-2-3-6;1-3-4-5-6-7-2/h1,4-6H,2-3H2;3-6H2,1-2H3.
What are the key properties of 1-cyclopropylpyrazole;1-methoxypentane?
1-cyclopropylpyrazole;1-methoxypentane has a molecular weight of 210.32 g/mol, XLogP of 3.04, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropylpyrazole;1-methoxypentane is sourced from PubChem (CID 168887617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).