C29H27F3N6O3S2 — CID 168888549
2-[7-cyclopropyl-6-[[4-(4-cyclopropyl-1,1,5-trioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-7-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]acetonitrile (PubChem CID 168888549) has the molecular formula C29H27F3N6O3S2 and a molecular weight of 628.70 g/mol. Its IUPAC name is 2-[7-cyclopropyl-6-[[4-(4-cyclopropyl-1,1,5-trioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-7-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]acetonitrile.
| Compound Name | 2-[7-cyclopropyl-6-[[4-(4-cyclopropyl-1,1,5-trioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-7-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 168888549 |
| Molecular Formula | C29H27F3N6O3S2 |
| Molecular Weight | 628.70 g/mol |
| Exact Mass | 628.15 |
| IUPAC Name | 2-[7-cyclopropyl-6-[[4-(4-cyclopropyl-1,1,5-trioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-7-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]acetonitrile |
| SMILES | N#CCN1CCc2cc(Nc3ncc(C(F)(F)F)c(-c4cc5c(s4)C(=O)N(C4CC4)CCS5(=O)=O)n3)c(C3CC3)cc2C1 |
| InChI | InChI=1S/C29H27F3N6O3S2/c30-29(31,32)21-14-34-28(35-22-12-17-5-7-37(8-6-33)15-18(17)11-20(22)16-1-2-16)36-25(21)23-13-24-26(42-23)27(39)38(19-3-4-19)9-10-43(24,40)41/h11-14,16,19H,1-5,7-10,15H2,(H,34,35,36) |
| InChIKey | ZMYYJRGXEWBGJH-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.70 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|