C30H30F3N5OS2 — CID 168889007
4-cyclopropyl-7-[2-[(2,7-dicyclopropyl-3,4-dihydro-1H-isoquinolin-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one (PubChem CID 168889007) has the molecular formula C30H30F3N5OS2 and a molecular weight of 597.73 g/mol. Its IUPAC name is 4-cyclopropyl-7-[2-[(2,7-dicyclopropyl-3,4-dihydro-1H-isoquinolin-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one.
| Compound Name | 4-cyclopropyl-7-[2-[(2,7-dicyclopropyl-3,4-dihydro-1H-isoquinolin-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
|---|---|
| PubChem CID | 168889007 |
| Molecular Formula | C30H30F3N5OS2 |
| Molecular Weight | 597.73 g/mol |
| Exact Mass | 597.18 |
| IUPAC Name | 4-cyclopropyl-7-[2-[(2,7-dicyclopropyl-3,4-dihydro-1H-isoquinolin-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
| SMILES | O=C1c2sc(-c3nc(Nc4cc5c(cc4C4CC4)CN(C4CC4)CC5)ncc3C(F)(F)F)cc2SCCN1C1CC1 |
| InChI | InChI=1S/C30H30F3N5OS2/c31-30(32,33)22-14-34-29(36-26(22)24-13-25-27(41-24)28(39)38(9-10-40-25)20-5-6-20)35-23-12-17-7-8-37(19-3-4-19)15-18(17)11-21(23)16-1-2-16/h11-14,16,19-20H,1-10,15H2,(H,34,35,36) |
| InChIKey | WTQSHMZHPHSLHP-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.73 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |