C27H27F3N6OS2 — CID 172575627
7-[2-[2-cyclopropyl-4-[(1S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-methyl-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one (PubChem CID 172575627) has the molecular formula C27H27F3N6OS2 and a molecular weight of 572.68 g/mol. Its IUPAC name is 7-[2-[2-cyclopropyl-4-[(1S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-methyl-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one.
| Compound Name | 7-[2-[2-cyclopropyl-4-[(1S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-methyl-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
|---|---|
| PubChem CID | 172575627 |
| Molecular Formula | C27H27F3N6OS2 |
| Molecular Weight | 572.68 g/mol |
| Exact Mass | 572.16 |
| IUPAC Name | 7-[2-[2-cyclopropyl-4-[(1S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-methyl-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
| SMILES | CN1CCSc2cc(-c3nc(Nc4ccc(N5CC6C[C@H]5CN6)cc4C4CC4)ncc3C(F)(F)F)sc2C1=O |
| InChI | InChI=1S/C27H27F3N6OS2/c1-35-6-7-38-22-10-21(39-24(22)25(35)37)23-19(27(28,29)30)12-32-26(34-23)33-20-5-4-16(9-18(20)14-2-3-14)36-13-15-8-17(36)11-31-15/h4-5,9-10,12,14-15,17,31H,2-3,6-8,11,13H2,1H3,(H,32,33,34)/t15?,17-/m0/s1 |
| InChIKey | WOUXSTQWTKLWAR-LWKPJOBUSA-N |
| XLogP | 5.57 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.68 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |