C31H34F3N7O2S2 — CID 168888598
7-[2-[2-cyclopropyl-4-(2-methyl-2,5,8-triazaspiro[3.5]nonan-8-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-(oxetan-3-yl)-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one (PubChem CID 168888598) has the molecular formula C31H34F3N7O2S2 and a molecular weight of 657.79 g/mol. Its IUPAC name is 7-[2-[2-cyclopropyl-4-(2-methyl-2,5,8-triazaspiro[3.5]nonan-8-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-(oxetan-3-yl)-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one.
| Compound Name | 7-[2-[2-cyclopropyl-4-(2-methyl-2,5,8-triazaspiro[3.5]nonan-8-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-(oxetan-3-yl)-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
|---|---|
| PubChem CID | 168888598 |
| Molecular Formula | C31H34F3N7O2S2 |
| Molecular Weight | 657.79 g/mol |
| Exact Mass | 657.22 |
| IUPAC Name | 7-[2-[2-cyclopropyl-4-(2-methyl-2,5,8-triazaspiro[3.5]nonan-8-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-(oxetan-3-yl)-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
| SMILES | CN1CC2(C1)CN(c1ccc(Nc3ncc(C(F)(F)F)c(-c4cc5c(s4)C(=O)N(C4COC4)CCS5)n3)c(C3CC3)c1)CCN2 |
| InChI | InChI=1S/C31H34F3N7O2S2/c1-39-15-30(16-39)17-40(7-6-36-30)19-4-5-23(21(10-19)18-2-3-18)37-29-35-12-22(31(32,33)34)26(38-29)24-11-25-27(45-24)28(42)41(8-9-44-25)20-13-43-14-20/h4-5,10-12,18,20,36H,2-3,6-9,13-17H2,1H3,(H,35,37,38) |
| InChIKey | WCDOEVADMAMAEY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.79 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |