C32H34F6N6O5S2 — CID 168889212
7-[2-[2-ethyl-4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-(oxetan-3-yl)-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one;methyl acetate (PubChem CID 168889212) has the molecular formula C32H34F6N6O5S2 and a molecular weight of 760.78 g/mol. Its IUPAC name is 7-[2-[2-ethyl-4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-(oxetan-3-yl)-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one;methyl acetate.
| Compound Name | 7-[2-[2-ethyl-4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-(oxetan-3-yl)-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one;methyl acetate |
|---|---|
| PubChem CID | 168889212 |
| Molecular Formula | C32H34F6N6O5S2 |
| Molecular Weight | 760.78 g/mol |
| Exact Mass | 760.19 |
| IUPAC Name | 7-[2-[2-ethyl-4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-(oxetan-3-yl)-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one;methyl acetate |
| SMILES | CCc1cc(N2CCN(C(=O)C(F)(F)F)CC2)ccc1Nc1ncc(C(F)(F)F)c(-c2cc3c(s2)C(=O)N(C2COC2)CCS3)n1.COC(C)=O |
| InChI | InChI=1S/C29H28F6N6O3S2.C3H6O2/c1-2-16-11-17(39-5-7-40(8-6-39)26(43)29(33,34)35)3-4-20(16)37-27-36-13-19(28(30,31)32)23(38-27)21-12-22-24(46-21)25(42)41(9-10-45-22)18-14-44-15-18;1-3(4)5-2/h3-4,11-13,18H,2,5-10,14-15H2,1H3,(H,36,37,38);1-2H3 |
| InChIKey | IYVWTGZMEFRGTM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.78 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|