C30H31F6N5O2S2 — CID 168888813
7-[2-[2-ethyl-4-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-(oxetan-3-yl)-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one (PubChem CID 168888813) has the molecular formula C30H31F6N5O2S2 and a molecular weight of 671.73 g/mol. Its IUPAC name is 7-[2-[2-ethyl-4-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-(oxetan-3-yl)-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one.
| Compound Name | 7-[2-[2-ethyl-4-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-(oxetan-3-yl)-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
|---|---|
| PubChem CID | 168888813 |
| Molecular Formula | C30H31F6N5O2S2 |
| Molecular Weight | 671.73 g/mol |
| Exact Mass | 671.18 |
| IUPAC Name | 7-[2-[2-ethyl-4-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-(oxetan-3-yl)-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
| SMILES | CCc1cc(C2CCN(CC(F)(F)F)CC2)ccc1Nc1ncc(C(F)(F)F)c(-c2cc3c(s2)C(=O)N(C2COC2)CCS3)n1 |
| InChI | InChI=1S/C30H31F6N5O2S2/c1-2-17-11-19(18-5-7-40(8-6-18)16-29(31,32)33)3-4-22(17)38-28-37-13-21(30(34,35)36)25(39-28)23-12-24-26(45-23)27(42)41(9-10-44-24)20-14-43-15-20/h3-4,11-13,18,20H,2,5-10,14-16H2,1H3,(H,37,38,39) |
| InChIKey | JHAZDMQYHPZSRY-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.73 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |