C30H35F3N6O3S2 — CID 168889099
4-cyclopropyl-7-[2-[2-ethyl-4-[(3S,5S)-3,4,5-trimethylpiperazin-1-yl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one (PubChem CID 168889099) has the molecular formula C30H35F3N6O3S2 and a molecular weight of 648.78 g/mol. Its IUPAC name is 4-cyclopropyl-7-[2-[2-ethyl-4-[(3S,5S)-3,4,5-trimethylpiperazin-1-yl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one.
| Compound Name | 4-cyclopropyl-7-[2-[2-ethyl-4-[(3S,5S)-3,4,5-trimethylpiperazin-1-yl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
|---|---|
| PubChem CID | 168889099 |
| Molecular Formula | C30H35F3N6O3S2 |
| Molecular Weight | 648.78 g/mol |
| Exact Mass | 648.22 |
| IUPAC Name | 4-cyclopropyl-7-[2-[2-ethyl-4-[(3S,5S)-3,4,5-trimethylpiperazin-1-yl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
| SMILES | CCc1cc(N2C[C@H](C)N(C)[C@@H](C)C2)ccc1Nc1ncc(C(F)(F)F)c(-c2cc3c(s2)C(=O)N(C2CC2)CCS3(=O)=O)n1 |
| InChI | InChI=1S/C30H35F3N6O3S2/c1-5-19-12-21(38-15-17(2)37(4)18(3)16-38)8-9-23(19)35-29-34-14-22(30(31,32)33)26(36-29)24-13-25-27(43-24)28(40)39(20-6-7-20)10-11-44(25,41)42/h8-9,12-14,17-18,20H,5-7,10-11,15-16H2,1-4H3,(H,34,35,36)/t17-,18-/m0/s1 |
| InChIKey | CNMCUBTUCGTARG-ROUUACIJSA-N |
| XLogP | 5.45 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.78 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|