C26H29F3N6O4S2 — CID 170317895
7-[2-[2-ethyl-4-[2-(hydroxymethyl)piperazin-1-yl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-methyl-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one (PubChem CID 170317895) has the molecular formula C26H29F3N6O4S2 and a molecular weight of 610.68 g/mol. Its IUPAC name is 7-[2-[2-ethyl-4-[2-(hydroxymethyl)piperazin-1-yl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-methyl-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one.
| Compound Name | 7-[2-[2-ethyl-4-[2-(hydroxymethyl)piperazin-1-yl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-methyl-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
|---|---|
| PubChem CID | 170317895 |
| Molecular Formula | C26H29F3N6O4S2 |
| Molecular Weight | 610.68 g/mol |
| Exact Mass | 610.16 |
| IUPAC Name | 7-[2-[2-ethyl-4-[2-(hydroxymethyl)piperazin-1-yl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-methyl-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
| SMILES | CCc1cc(N2CCNCC2CO)ccc1Nc1ncc(C(F)(F)F)c(-c2cc3c(s2)C(=O)N(C)CCS3(=O)=O)n1 |
| InChI | InChI=1S/C26H29F3N6O4S2/c1-3-15-10-16(35-7-6-30-12-17(35)14-36)4-5-19(15)32-25-31-13-18(26(27,28)29)22(33-25)20-11-21-23(40-20)24(37)34(2)8-9-41(21,38)39/h4-5,10-11,13,17,30,36H,3,6-9,12,14H2,1-2H3,(H,31,32,33) |
| InChIKey | GJQNUVCJKIOMLI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.68 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |