C27H29F3N6O3S3 — CID 170317737
7-[2-[4-(2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazin-4-yl)-2-ethylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-methyl-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepine-5-thione (PubChem CID 170317737) has the molecular formula C27H29F3N6O3S3 and a molecular weight of 638.76 g/mol. Its IUPAC name is 7-[2-[4-(2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazin-4-yl)-2-ethylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-methyl-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepine-5-thione.
| Compound Name | 7-[2-[4-(2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazin-4-yl)-2-ethylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-methyl-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepine-5-thione |
|---|---|
| PubChem CID | 170317737 |
| Molecular Formula | C27H29F3N6O3S3 |
| Molecular Weight | 638.76 g/mol |
| Exact Mass | 638.14 |
| IUPAC Name | 7-[2-[4-(2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazin-4-yl)-2-ethylanilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-methyl-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepine-5-thione |
| SMILES | CCc1cc(N2CCNC3COCC32)ccc1Nc1ncc(C(F)(F)F)c(-c2cc3c(s2)C(=S)N(C)CCS3(=O)=O)n1 |
| InChI | InChI=1S/C27H29F3N6O3S3/c1-3-15-10-16(36-7-6-31-19-13-39-14-20(19)36)4-5-18(15)33-26-32-12-17(27(28,29)30)23(34-26)21-11-22-24(41-21)25(40)35(2)8-9-42(22,37)38/h4-5,10-12,19-20,31H,3,6-9,13-14H2,1-2H3,(H,32,33,34) |
| InChIKey | PETLBADQFMBSOP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.76 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|