C14H19NO3 — CID 168890716
[1-(2-amino-2-oxoethyl)-2-bicyclo[2.2.1]heptanylidene]methyl 2-methylprop-2-enoate (PubChem CID 168890716) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is [1-(2-amino-2-oxoethyl)-2-bicyclo[2.2.1]heptanylidene]methyl 2-methylprop-2-enoate.
| Compound Name | [1-(2-amino-2-oxoethyl)-2-bicyclo[2.2.1]heptanylidene]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 168890716 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | [1-(2-amino-2-oxoethyl)-2-bicyclo[2.2.1]heptanylidene]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC=C1CC2CCC1(CC(N)=O)C2 |
| InChI | InChI=1S/C14H19NO3/c1-9(2)13(17)18-8-11-5-10-3-4-14(11,6-10)7-12(15)16/h8,10H,1,3-7H2,2H3,(H2,15,16) |
| InChIKey | PSLBMCFXDCWZSK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|