C17H29N3O4 — CID 168891350
(3-aminopyrrolidin-1-yl)-(2-hydroxy-3-methoxyphenyl)methanone;ethane;N-ethylformamide (PubChem CID 168891350) has the molecular formula C17H29N3O4 and a molecular weight of 339.44 g/mol. Its IUPAC name is (3-aminopyrrolidin-1-yl)-(2-hydroxy-3-methoxyphenyl)methanone;ethane;N-ethylformamide.
| Compound Name | (3-aminopyrrolidin-1-yl)-(2-hydroxy-3-methoxyphenyl)methanone;ethane;N-ethylformamide |
|---|---|
| PubChem CID | 168891350 |
| Molecular Formula | C17H29N3O4 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | (3-aminopyrrolidin-1-yl)-(2-hydroxy-3-methoxyphenyl)methanone;ethane;N-ethylformamide |
| SMILES | CC.CCNC=O.COc1cccc(C(=O)N2CCC(N)C2)c1O |
| InChI | InChI=1S/C12H16N2O3.C3H7NO.C2H6/c1-17-10-4-2-3-9(11(10)15)12(16)14-6-5-8(13)7-14;1-2-4-3-5;1-2/h2-4,8,15H,5-7,13H2,1H3;3H,2H2,1H3,(H,4,5);1-2H3 |
| InChIKey | ISTVOSUGNGBCMC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|