C18H24N4O2 — CID 168892814
5-cyano-1-N-cyclopropyl-3-N-phenylpyrrolidine-1,3-dicarboxamide;ethane (PubChem CID 168892814) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 5-cyano-1-N-cyclopropyl-3-N-phenylpyrrolidine-1,3-dicarboxamide;ethane.
| Compound Name | 5-cyano-1-N-cyclopropyl-3-N-phenylpyrrolidine-1,3-dicarboxamide;ethane |
|---|---|
| PubChem CID | 168892814 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 5-cyano-1-N-cyclopropyl-3-N-phenylpyrrolidine-1,3-dicarboxamide;ethane |
| SMILES | CC.N#CC1CC(C(=O)Nc2ccccc2)CN1C(=O)NC1CC1 |
| InChI | InChI=1S/C16H18N4O2.C2H6/c17-9-14-8-11(10-20(14)16(22)19-13-6-7-13)15(21)18-12-4-2-1-3-5-12;1-2/h1-5,11,13-14H,6-8,10H2,(H,18,21)(H,19,22);1-2H3 |
| InChIKey | RVNJNTVODJKLLI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |