C23H30N6O3 — CID 174008983
1-[2-[[3-amino-2-(tert-butyliminomethyl)prop-2-enoyl]-methylamino]acetyl]-5-cyano-N-phenylpyrrolidine-3-carboxamide (PubChem CID 174008983) has the molecular formula C23H30N6O3 and a molecular weight of 438.53 g/mol. Its IUPAC name is 1-[2-[[3-amino-2-(tert-butyliminomethyl)prop-2-enoyl]-methylamino]acetyl]-5-cyano-N-phenylpyrrolidine-3-carboxamide.
| Compound Name | 1-[2-[[3-amino-2-(tert-butyliminomethyl)prop-2-enoyl]-methylamino]acetyl]-5-cyano-N-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 174008983 |
| Molecular Formula | C23H30N6O3 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 1-[2-[[3-amino-2-(tert-butyliminomethyl)prop-2-enoyl]-methylamino]acetyl]-5-cyano-N-phenylpyrrolidine-3-carboxamide |
| SMILES | CN(CC(=O)N1CC(C(=O)Nc2ccccc2)CC1C#N)C(=O)C(=CN)/C=N/C(C)(C)C |
| InChI | InChI=1S/C23H30N6O3/c1-23(2,3)26-13-17(11-24)22(32)28(4)15-20(30)29-14-16(10-19(29)12-25)21(31)27-18-8-6-5-7-9-18/h5-9,11,13,16,19H,10,14-15,24H2,1-4H3,(H,27,31)/b17-11?,26-13+ |
| InChIKey | KUBYKHWIRZIIQU-KBEVYUEXSA-N |
| XLogP | 1.54 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|