C24H22F3N5O4 — CID 166487967
N'-[2-[2-cyano-4-(phenylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]-N-phenyl-N'-(2,2,2-trifluoroethyl)oxamide (PubChem CID 166487967) has the molecular formula C24H22F3N5O4 and a molecular weight of 501.47 g/mol. Its IUPAC name is N'-[2-[2-cyano-4-(phenylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]-N-phenyl-N'-(2,2,2-trifluoroethyl)oxamide.
| Compound Name | N'-[2-[2-cyano-4-(phenylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]-N-phenyl-N'-(2,2,2-trifluoroethyl)oxamide |
|---|---|
| PubChem CID | 166487967 |
| Molecular Formula | C24H22F3N5O4 |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | N'-[2-[2-cyano-4-(phenylcarbamoyl)pyrrolidin-1-yl]-2-oxoethyl]-N-phenyl-N'-(2,2,2-trifluoroethyl)oxamide |
| SMILES | N#CC1CC(C(=O)Nc2ccccc2)CN1C(=O)CN(CC(F)(F)F)C(=O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C24H22F3N5O4/c25-24(26,27)15-31(23(36)22(35)30-18-9-5-2-6-10-18)14-20(33)32-13-16(11-19(32)12-28)21(34)29-17-7-3-1-4-8-17/h1-10,16,19H,11,13-15H2,(H,29,34)(H,30,35) |
| InChIKey | FMJCPZJCIWIHPA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 122.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|