C13H21N3 — CID 168893821
1-(2-propylpentanimidoyl)pyridin-2-imine (PubChem CID 168893821) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 1-(2-propylpentanimidoyl)pyridin-2-imine.
| Compound Name | 1-(2-propylpentanimidoyl)pyridin-2-imine |
|---|---|
| PubChem CID | 168893821 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 1-(2-propylpentanimidoyl)pyridin-2-imine |
| SMILES | [H]/N=C(\C(CCC)CCC)n1cccc/c1=N\[H] |
| InChI | InChI=1S/C13H21N3/c1-3-7-11(8-4-2)13(15)16-10-6-5-9-12(16)14/h5-6,9-11,14-15H,3-4,7-8H2,1-2H3/b14-12+,15-13+ |
| InChIKey | ZUVVFINIDSBEQH-QUMQEAAQSA-N |
| XLogP | 3.01 |
| TPSA | 52.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|