C13H19N3 — CID 168894222
1-(cyclohexanecarboximidoyl)-5-methylpyridin-2-imine (PubChem CID 168894222) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 1-(cyclohexanecarboximidoyl)-5-methylpyridin-2-imine.
| Compound Name | 1-(cyclohexanecarboximidoyl)-5-methylpyridin-2-imine |
|---|---|
| PubChem CID | 168894222 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 1-(cyclohexanecarboximidoyl)-5-methylpyridin-2-imine |
| SMILES | [H]/N=C(\C1CCCCC1)n1cc(C)cc/c1=N\[H] |
| InChI | InChI=1S/C13H19N3/c1-10-7-8-12(14)16(9-10)13(15)11-5-3-2-4-6-11/h7-9,11,14-15H,2-6H2,1H3/b14-12+,15-13+ |
| InChIKey | YYVZWUNLMYZEDQ-QUMQEAAQSA-N |
| XLogP | 2.68 |
| TPSA | 52.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|