About 1-(cyclohexanecarboximidoyl)-5-(trifluoromethyl)pyridin-2-imine;methoxymethane
1-(cyclohexanecarboximidoyl)-5-(trifluoromethyl)pyridin-2-imine;methoxymethane (PubChem CID 168894158) has the molecular formula C15H22F3N3O
and a molecular weight of 317.35 g/mol. Its IUPAC name is 1-(cyclohexanecarboximidoyl)-5-(trifluoromethyl)pyridin-2-imine;methoxymethane.
Molecular Properties
| Compound Name | 1-(cyclohexanecarboximidoyl)-5-(trifluoromethyl)pyridin-2-imine;methoxymethane |
| PubChem CID | 168894158 |
| Molecular Formula | C15H22F3N3O |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 1-(cyclohexanecarboximidoyl)-5-(trifluoromethyl)pyridin-2-imine;methoxymethane |
| SMILES | COC.[H]/N=C(\C1CCCCC1)n1cc(C(F)(F)F)cc/c1=N\[H] |
| InChI | InChI=1S/C13H16F3N3.C2H6O/c14-13(15,16)10-6-7-11(17)19(8-10)12(18)9-4-2-1-3-5-9;1-3-2/h6-9,17-18H,1-5H2;1-2H3/b17-11+,18-12+; |
| InChIKey | ZDUBJHLJINUJGK-OYJDLGDISA-N |
| XLogP | 3.65 |
| TPSA | 61.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(cyclohexanecarboximidoyl)-5-(trifluoromethyl)pyridin-2-imine;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexanecarboximidoyl)-5-(trifluoromethyl)pyridin-2-imine;methoxymethane?
The IUPAC name of 1-(cyclohexanecarboximidoyl)-5-(trifluoromethyl)pyridin-2-imine;methoxymethane (CID 168894158) is 1-(cyclohexanecarboximidoyl)-5-(trifluoromethyl)pyridin-2-imine;methoxymethane.
What is the SMILES notation for 1-(cyclohexanecarboximidoyl)-5-(trifluoromethyl)pyridin-2-imine;methoxymethane?
The canonical SMILES for 1-(cyclohexanecarboximidoyl)-5-(trifluoromethyl)pyridin-2-imine;methoxymethane is COC.[H]/N=C(\C1CCCCC1)n1cc(C(F)(F)F)cc/c1=N\[H].
What is the InChIKey of 1-(cyclohexanecarboximidoyl)-5-(trifluoromethyl)pyridin-2-imine;methoxymethane?
The InChIKey is ZDUBJHLJINUJGK-OYJDLGDISA-N. The full InChI is InChI=1S/C13H16F3N3.C2H6O/c14-13(15,16)10-6-7-11(17)19(8-10)12(18)9-4-2-1-3-5-9;1-3-2/h6-9,17-18H,1-5H2;1-2H3/b17-11+,18-12+;.
What are the key properties of 1-(cyclohexanecarboximidoyl)-5-(trifluoromethyl)pyridin-2-imine;methoxymethane?
1-(cyclohexanecarboximidoyl)-5-(trifluoromethyl)pyridin-2-imine;methoxymethane has a molecular weight of 317.35 g/mol, XLogP of 3.65, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexanecarboximidoyl)-5-(trifluoromethyl)pyridin-2-imine;methoxymethane is sourced from PubChem (CID 168894158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).