About [(1R,3S)-3-[3-[(5-cyanopyrazin-2-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-cyclobutylcarbamate
[(1R,3S)-3-[3-[(5-cyanopyrazin-2-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-cyclobutylcarbamate (PubChem CID 168894960) has the molecular formula C18H21N7O2
and a molecular weight of 367.41 g/mol. Its IUPAC name is [(1R,3S)-3-[3-[(5-cyanopyrazin-2-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-cyclobutylcarbamate.
Molecular Properties
| Compound Name | [(1R,3S)-3-[3-[(5-cyanopyrazin-2-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-cyclobutylcarbamate |
| PubChem CID | 168894960 |
| Molecular Formula | C18H21N7O2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | [(1R,3S)-3-[3-[(5-cyanopyrazin-2-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-cyclobutylcarbamate |
| SMILES | N#Cc1cnc(Nc2cc([C@H]3CC[C@@H](OC(=O)NC4CCC4)C3)[nH]n2)cn1 |
| InChI | InChI=1S/C18H21N7O2/c19-8-13-9-21-17(10-20-13)23-16-7-15(24-25-16)11-4-5-14(6-11)27-18(26)22-12-2-1-3-12/h7,9-12,14H,1-6H2,(H,22,26)(H2,21,23,24,25)/t11-,14+/m0/s1 |
| InChIKey | BQVJVKARBHAZMA-SMDDNHRTSA-N |
| XLogP | 2.73 |
| TPSA | 128.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(1R,3S)-3-[3-[(5-cyanopyrazin-2-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-cyclobutylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,3S)-3-[3-[(5-cyanopyrazin-2-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-cyclobutylcarbamate?
The IUPAC name of [(1R,3S)-3-[3-[(5-cyanopyrazin-2-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-cyclobutylcarbamate (CID 168894960) is [(1R,3S)-3-[3-[(5-cyanopyrazin-2-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-cyclobutylcarbamate.
What is the SMILES notation for [(1R,3S)-3-[3-[(5-cyanopyrazin-2-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-cyclobutylcarbamate?
The canonical SMILES for [(1R,3S)-3-[3-[(5-cyanopyrazin-2-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-cyclobutylcarbamate is N#Cc1cnc(Nc2cc([C@H]3CC[C@@H](OC(=O)NC4CCC4)C3)[nH]n2)cn1.
What is the InChIKey of [(1R,3S)-3-[3-[(5-cyanopyrazin-2-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-cyclobutylcarbamate?
The InChIKey is BQVJVKARBHAZMA-SMDDNHRTSA-N. The full InChI is InChI=1S/C18H21N7O2/c19-8-13-9-21-17(10-20-13)23-16-7-15(24-25-16)11-4-5-14(6-11)27-18(26)22-12-2-1-3-12/h7,9-12,14H,1-6H2,(H,22,26)(H2,21,23,24,25)/t11-,14+/m0/s1.
What are the key properties of [(1R,3S)-3-[3-[(5-cyanopyrazin-2-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-cyclobutylcarbamate?
[(1R,3S)-3-[3-[(5-cyanopyrazin-2-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-cyclobutylcarbamate has a molecular weight of 367.41 g/mol, XLogP of 2.73, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,3S)-3-[3-[(5-cyanopyrazin-2-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] N-cyclobutylcarbamate is sourced from PubChem (CID 168894960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).