C18H25N7O2 — CID 168895028
[3-[3-[(5-cyanopyrazin-2-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] formate;N-methylpropan-1-amine (PubChem CID 168895028) has the molecular formula C18H25N7O2 and a molecular weight of 371.45 g/mol. Its IUPAC name is [3-[3-[(5-cyanopyrazin-2-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] formate;N-methylpropan-1-amine.
| Compound Name | [3-[3-[(5-cyanopyrazin-2-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] formate;N-methylpropan-1-amine |
|---|---|
| PubChem CID | 168895028 |
| Molecular Formula | C18H25N7O2 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | [3-[3-[(5-cyanopyrazin-2-yl)amino]-1H-pyrazol-5-yl]cyclopentyl] formate;N-methylpropan-1-amine |
| SMILES | CCCNC.N#Cc1cnc(Nc2cc(C3CCC(OC=O)C3)[nH]n2)cn1 |
| InChI | InChI=1S/C14H14N6O2.C4H11N/c15-5-10-6-17-14(7-16-10)18-13-4-12(19-20-13)9-1-2-11(3-9)22-8-21;1-3-4-5-2/h4,6-9,11H,1-3H2,(H2,17,18,19,20);5H,3-4H2,1-2H3 |
| InChIKey | GHTCKDYBQVASQN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 128.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|