C12H18N2O2 — CID 177323847
[3-(3-propan-2-yl-1H-pyrazol-5-yl)cyclopentyl] formate (PubChem CID 177323847) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is [3-(3-propan-2-yl-1H-pyrazol-5-yl)cyclopentyl] formate.
| Compound Name | [3-(3-propan-2-yl-1H-pyrazol-5-yl)cyclopentyl] formate |
|---|---|
| PubChem CID | 177323847 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | [3-(3-propan-2-yl-1H-pyrazol-5-yl)cyclopentyl] formate |
| SMILES | CC(C)c1cc(C2CCC(OC=O)C2)[nH]n1 |
| InChI | InChI=1S/C12H18N2O2/c1-8(2)11-6-12(14-13-11)9-3-4-10(5-9)16-7-15/h6-10H,3-5H2,1-2H3,(H,13,14) |
| InChIKey | GHQFJXYNPHNASY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|