C19H21N3O7 — CID 176998396
[3-[3-[[2-(2-formyl-3-hydroxy-5-methoxyphenoxy)acetyl]amino]-1H-pyrazol-5-yl]cyclopentyl] formate (PubChem CID 176998396) has the molecular formula C19H21N3O7 and a molecular weight of 403.39 g/mol. Its IUPAC name is [3-[3-[[2-(2-formyl-3-hydroxy-5-methoxyphenoxy)acetyl]amino]-1H-pyrazol-5-yl]cyclopentyl] formate.
| Compound Name | [3-[3-[[2-(2-formyl-3-hydroxy-5-methoxyphenoxy)acetyl]amino]-1H-pyrazol-5-yl]cyclopentyl] formate |
|---|---|
| PubChem CID | 176998396 |
| Molecular Formula | C19H21N3O7 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | [3-[3-[[2-(2-formyl-3-hydroxy-5-methoxyphenoxy)acetyl]amino]-1H-pyrazol-5-yl]cyclopentyl] formate |
| SMILES | COc1cc(O)c(C=O)c(OCC(=O)Nc2cc(C3CCC(OC=O)C3)[nH]n2)c1 |
| InChI | InChI=1S/C19H21N3O7/c1-27-13-5-16(25)14(8-23)17(6-13)28-9-19(26)20-18-7-15(21-22-18)11-2-3-12(4-11)29-10-24/h5-8,10-12,25H,2-4,9H2,1H3,(H2,20,21,22,26) |
| InChIKey | PEKLGKJGAHBMQH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|