C24H30N4O7 — CID 176997993
[(1R,3S)-3-[3-[[2-(2-formyl-3-hydroxy-5-methoxyphenoxy)-1-hydroxyethyl]amino]-1H-pyrazol-5-yl]cyclopentyl] N-(1-bicyclo[1.1.1]pentanyl)carbamate (PubChem CID 176997993) has the molecular formula C24H30N4O7 and a molecular weight of 486.53 g/mol. Its IUPAC name is [(1R,3S)-3-[3-[[2-(2-formyl-3-hydroxy-5-methoxyphenoxy)-1-hydroxyethyl]amino]-1H-pyrazol-5-yl]cyclopentyl] N-(1-bicyclo[1.1.1]pentanyl)carbamate.
| Compound Name | [(1R,3S)-3-[3-[[2-(2-formyl-3-hydroxy-5-methoxyphenoxy)-1-hydroxyethyl]amino]-1H-pyrazol-5-yl]cyclopentyl] N-(1-bicyclo[1.1.1]pentanyl)carbamate |
|---|---|
| PubChem CID | 176997993 |
| Molecular Formula | C24H30N4O7 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | [(1R,3S)-3-[3-[[2-(2-formyl-3-hydroxy-5-methoxyphenoxy)-1-hydroxyethyl]amino]-1H-pyrazol-5-yl]cyclopentyl] N-(1-bicyclo[1.1.1]pentanyl)carbamate |
| SMILES | COc1cc(O)c(C=O)c(OCC(O)Nc2cc([C@H]3CC[C@@H](OC(=O)NC45CC(C4)C5)C3)[nH]n2)c1 |
| InChI | InChI=1S/C24H30N4O7/c1-33-16-5-19(30)17(11-29)20(6-16)34-12-22(31)25-21-7-18(27-28-21)14-2-3-15(4-14)35-23(32)26-24-8-13(9-24)10-24/h5-7,11,13-15,22,30-31H,2-4,8-10,12H2,1H3,(H,26,32)(H2,25,27,28)/t13?,14-,15+,22?,24?/m0/s1 |
| InChIKey | RZMCNYVXBGIHKQ-PJWPJNFXSA-N |
| XLogP | 2.66 |
| TPSA | 155.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|