C25H34N4O7 — CID 176998141
[(1R,3S)-3-[3-[[2-(5-ethoxy-2-formyl-3-hydroxyphenoxy)-1-hydroxyethyl]amino]-1H-pyrazol-5-yl]cyclopentyl] 2,2-dimethylazetidine-1-carboxylate (PubChem CID 176998141) has the molecular formula C25H34N4O7 and a molecular weight of 502.57 g/mol. Its IUPAC name is [(1R,3S)-3-[3-[[2-(5-ethoxy-2-formyl-3-hydroxyphenoxy)-1-hydroxyethyl]amino]-1H-pyrazol-5-yl]cyclopentyl] 2,2-dimethylazetidine-1-carboxylate.
| Compound Name | [(1R,3S)-3-[3-[[2-(5-ethoxy-2-formyl-3-hydroxyphenoxy)-1-hydroxyethyl]amino]-1H-pyrazol-5-yl]cyclopentyl] 2,2-dimethylazetidine-1-carboxylate |
|---|---|
| PubChem CID | 176998141 |
| Molecular Formula | C25H34N4O7 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | [(1R,3S)-3-[3-[[2-(5-ethoxy-2-formyl-3-hydroxyphenoxy)-1-hydroxyethyl]amino]-1H-pyrazol-5-yl]cyclopentyl] 2,2-dimethylazetidine-1-carboxylate |
| SMILES | CCOc1cc(O)c(C=O)c(OCC(O)Nc2cc([C@H]3CC[C@@H](OC(=O)N4CCC4(C)C)C3)[nH]n2)c1 |
| InChI | InChI=1S/C25H34N4O7/c1-4-34-17-10-20(31)18(13-30)21(11-17)35-14-23(32)26-22-12-19(27-28-22)15-5-6-16(9-15)36-24(33)29-8-7-25(29,2)3/h10-13,15-16,23,31-32H,4-9,14H2,1-3H3,(H2,26,27,28)/t15-,16+,23?/m0/s1 |
| InChIKey | FBZIXGIITKPCDE-PLRGMUQMSA-N |
| XLogP | 3.39 |
| TPSA | 146.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|