About (Z)-1-(azetidin-3-yl)pent-2-ene-1,4-diimine
(Z)-1-(azetidin-3-yl)pent-2-ene-1,4-diimine (PubChem CID 168895404) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is (Z)-1-(azetidin-3-yl)pent-2-ene-1,4-diimine.
Molecular Properties
| Compound Name | (Z)-1-(azetidin-3-yl)pent-2-ene-1,4-diimine |
| PubChem CID | 168895404 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | (Z)-1-(azetidin-3-yl)pent-2-ene-1,4-diimine |
| SMILES | [H]/N=C(/C=C\C(C)=N\[H])C1CNC1 |
| InChI | InChI=1S/C8H13N3/c1-6(9)2-3-8(10)7-4-11-5-7/h2-3,7,9-11H,4-5H2,1H3/b3-2-,9-6+,10-8- |
| InChIKey | RGFHVKDSIJJJEF-REYHLNHTSA-N |
| XLogP | 0.82 |
| TPSA | 59.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-(azetidin-3-yl)pent-2-ene-1,4-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(azetidin-3-yl)pent-2-ene-1,4-diimine?
The IUPAC name of (Z)-1-(azetidin-3-yl)pent-2-ene-1,4-diimine (CID 168895404) is (Z)-1-(azetidin-3-yl)pent-2-ene-1,4-diimine.
What is the SMILES notation for (Z)-1-(azetidin-3-yl)pent-2-ene-1,4-diimine?
The canonical SMILES for (Z)-1-(azetidin-3-yl)pent-2-ene-1,4-diimine is [H]/N=C(/C=C\C(C)=N\[H])C1CNC1.
What is the InChIKey of (Z)-1-(azetidin-3-yl)pent-2-ene-1,4-diimine?
The InChIKey is RGFHVKDSIJJJEF-REYHLNHTSA-N. The full InChI is InChI=1S/C8H13N3/c1-6(9)2-3-8(10)7-4-11-5-7/h2-3,7,9-11H,4-5H2,1H3/b3-2-,9-6+,10-8-.
What are the key properties of (Z)-1-(azetidin-3-yl)pent-2-ene-1,4-diimine?
(Z)-1-(azetidin-3-yl)pent-2-ene-1,4-diimine has a molecular weight of 151.21 g/mol, XLogP of 0.82, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(azetidin-3-yl)pent-2-ene-1,4-diimine is sourced from PubChem (CID 168895404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).