C10H21N3 — CID 167486720
(Z)-4-(azetidin-3-yl)-4-methyliminobut-2-en-2-amine;ethane (PubChem CID 167486720) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is (Z)-4-(azetidin-3-yl)-4-methyliminobut-2-en-2-amine;ethane.
| Compound Name | (Z)-4-(azetidin-3-yl)-4-methyliminobut-2-en-2-amine;ethane |
|---|---|
| PubChem CID | 167486720 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | (Z)-4-(azetidin-3-yl)-4-methyliminobut-2-en-2-amine;ethane |
| SMILES | C/N=C(/C=C(/C)N)C1CNC1.CC |
| InChI | InChI=1S/C8H15N3.C2H6/c1-6(9)3-8(10-2)7-4-11-5-7;1-2/h3,7,11H,4-5,9H2,1-2H3;1-2H3/b6-3-,10-8-; |
| InChIKey | DHEBYYFHKWXHTP-MXUSMDBPSA-N |
| XLogP | 1.17 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|