C15H10N4O2 — CID 168895745
phenyl N'-(1,3-benzoxazol-4-yl)-N-cyanocarbamimidate (PubChem CID 168895745) has the molecular formula C15H10N4O2 and a molecular weight of 278.27 g/mol. Its IUPAC name is phenyl N'-(1,3-benzoxazol-4-yl)-N-cyanocarbamimidate.
| Compound Name | phenyl N'-(1,3-benzoxazol-4-yl)-N-cyanocarbamimidate |
|---|---|
| PubChem CID | 168895745 |
| Molecular Formula | C15H10N4O2 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | phenyl N'-(1,3-benzoxazol-4-yl)-N-cyanocarbamimidate |
| SMILES | N#CN/C(=N\c1cccc2ocnc12)Oc1ccccc1 |
| InChI | InChI=1S/C15H10N4O2/c16-9-17-15(21-11-5-2-1-3-6-11)19-12-7-4-8-13-14(12)18-10-20-13/h1-8,10H,(H,17,19) |
| InChIKey | HZORJVUSYBJKSM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|