About phenyl N-cyano-N'-[6-(2-fluoroethylamino)-3-pyridinyl]carbamimidate
phenyl N-cyano-N'-[6-(2-fluoroethylamino)-3-pyridinyl]carbamimidate (PubChem CID 22911634) has the molecular formula C15H14FN5O
and a molecular weight of 299.31 g/mol. Its IUPAC name is phenyl N-cyano-N'-[6-(2-fluoroethylamino)-3-pyridinyl]carbamimidate.
Molecular Properties
| Compound Name | phenyl N-cyano-N'-[6-(2-fluoroethylamino)-3-pyridinyl]carbamimidate |
| PubChem CID | 22911634 |
| Molecular Formula | C15H14FN5O |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | phenyl N-cyano-N'-[6-(2-fluoroethylamino)-3-pyridinyl]carbamimidate |
| SMILES | N#CN/C(=N\c1ccc(NCCF)nc1)Oc1ccccc1 |
| InChI | InChI=1S/C15H14FN5O/c16-8-9-18-14-7-6-12(10-19-14)21-15(20-11-17)22-13-4-2-1-3-5-13/h1-7,10H,8-9H2,(H,18,19)(H,20,21) |
| InChIKey | GOAHWKOUEALVKU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze phenyl N-cyano-N'-[6-(2-fluoroethylamino)-3-pyridinyl]carbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-cyano-N'-[6-(2-fluoroethylamino)-3-pyridinyl]carbamimidate?
The IUPAC name of phenyl N-cyano-N'-[6-(2-fluoroethylamino)-3-pyridinyl]carbamimidate (CID 22911634) is phenyl N-cyano-N'-[6-(2-fluoroethylamino)-3-pyridinyl]carbamimidate.
What is the SMILES notation for phenyl N-cyano-N'-[6-(2-fluoroethylamino)-3-pyridinyl]carbamimidate?
The canonical SMILES for phenyl N-cyano-N'-[6-(2-fluoroethylamino)-3-pyridinyl]carbamimidate is N#CN/C(=N\c1ccc(NCCF)nc1)Oc1ccccc1.
What is the InChIKey of phenyl N-cyano-N'-[6-(2-fluoroethylamino)-3-pyridinyl]carbamimidate?
The InChIKey is GOAHWKOUEALVKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14FN5O/c16-8-9-18-14-7-6-12(10-19-14)21-15(20-11-17)22-13-4-2-1-3-5-13/h1-7,10H,8-9H2,(H,18,19)(H,20,21).
What are the key properties of phenyl N-cyano-N'-[6-(2-fluoroethylamino)-3-pyridinyl]carbamimidate?
phenyl N-cyano-N'-[6-(2-fluoroethylamino)-3-pyridinyl]carbamimidate has a molecular weight of 299.31 g/mol, XLogP of 2.60, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-cyano-N'-[6-(2-fluoroethylamino)-3-pyridinyl]carbamimidate is sourced from PubChem (CID 22911634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).