C12H22N4 — CID 168896935
(E)-3-[1-(cyclopropylmethyl)piperidin-4-yl]iminoprop-1-ene-1,2-diamine (PubChem CID 168896935) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is (E)-3-[1-(cyclopropylmethyl)piperidin-4-yl]iminoprop-1-ene-1,2-diamine.
| Compound Name | (E)-3-[1-(cyclopropylmethyl)piperidin-4-yl]iminoprop-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 168896935 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | (E)-3-[1-(cyclopropylmethyl)piperidin-4-yl]iminoprop-1-ene-1,2-diamine |
| SMILES | N/C=C(N)\C=N\C1CCN(CC2CC2)CC1 |
| InChI | InChI=1S/C12H22N4/c13-7-11(14)8-15-12-3-5-16(6-4-12)9-10-1-2-10/h7-8,10,12H,1-6,9,13-14H2/b11-7+,15-8+ |
| InChIKey | FFDDZDNMGVSBMA-YQQAFNMCSA-N |
| XLogP | 0.69 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|