C37H21N5 — CID 168897040
17-(4,6-diphenyl-1,3,5-triazin-2-yl)pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15(20),16,18-nonaene-4,11-dicarbonitrile (PubChem CID 168897040) has the molecular formula C37H21N5 and a molecular weight of 535.61 g/mol. Its IUPAC name is 17-(4,6-diphenyl-1,3,5-triazin-2-yl)pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15(20),16,18-nonaene-4,11-dicarbonitrile.
| Compound Name | 17-(4,6-diphenyl-1,3,5-triazin-2-yl)pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15(20),16,18-nonaene-4,11-dicarbonitrile |
|---|---|
| PubChem CID | 168897040 |
| Molecular Formula | C37H21N5 |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | 17-(4,6-diphenyl-1,3,5-triazin-2-yl)pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15(20),16,18-nonaene-4,11-dicarbonitrile |
| SMILES | N#Cc1ccc2c(c1)C1c3ccc(C#N)cc3C2c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc21 |
| InChI | InChI=1S/C37H21N5/c38-20-22-12-15-28-30(17-22)33-27-14-11-23(21-39)18-31(27)34(28)32-19-26(13-16-29(32)33)37-41-35(24-7-3-1-4-8-24)40-36(42-37)25-9-5-2-6-10-25/h1-19,33-34H |
| InChIKey | DNPBXAAYYDBCCF-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 86.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |