C13H17F4NOS — CID 168898397
N-tert-butylsulfanyl-2,2,2-trifluoro-1-(4-fluoro-3-methoxyphenyl)ethanamine (PubChem CID 168898397) has the molecular formula C13H17F4NOS and a molecular weight of 311.34 g/mol. Its IUPAC name is N-tert-butylsulfanyl-2,2,2-trifluoro-1-(4-fluoro-3-methoxyphenyl)ethanamine.
| Compound Name | N-tert-butylsulfanyl-2,2,2-trifluoro-1-(4-fluoro-3-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 168898397 |
| Molecular Formula | C13H17F4NOS |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | N-tert-butylsulfanyl-2,2,2-trifluoro-1-(4-fluoro-3-methoxyphenyl)ethanamine |
| SMILES | COc1cc(C(NSC(C)(C)C)C(F)(F)F)ccc1F |
| InChI | InChI=1S/C13H17F4NOS/c1-12(2,3)20-18-11(13(15,16)17)8-5-6-9(14)10(7-8)19-4/h5-7,11,18H,1-4H3 |
| InChIKey | ZCZUGJRFNNKBLK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|