C13H11ClF3N3S — CID 168899197
1-(4-chlorophenyl)-2,2,2-trifluoro-N-methyl-N-pyridazin-3-ylsulfanylethanamine (PubChem CID 168899197) has the molecular formula C13H11ClF3N3S and a molecular weight of 333.77 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,2,2-trifluoro-N-methyl-N-pyridazin-3-ylsulfanylethanamine.
| Compound Name | 1-(4-chlorophenyl)-2,2,2-trifluoro-N-methyl-N-pyridazin-3-ylsulfanylethanamine |
|---|---|
| PubChem CID | 168899197 |
| Molecular Formula | C13H11ClF3N3S |
| Molecular Weight | 333.77 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 1-(4-chlorophenyl)-2,2,2-trifluoro-N-methyl-N-pyridazin-3-ylsulfanylethanamine |
| SMILES | CN(Sc1cccnn1)C(c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C13H11ClF3N3S/c1-20(21-11-3-2-8-18-19-11)12(13(15,16)17)9-4-6-10(14)7-5-9/h2-8,12H,1H3 |
| InChIKey | CMNUBWORAJUDEV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.77 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|