C13H11ClF3N3O2S — CID 175581064
N-[1-(4-chlorophenyl)-1,2,2-trifluoroethyl]-N-methylpyridazine-3-sulfonamide (PubChem CID 175581064) has the molecular formula C13H11ClF3N3O2S and a molecular weight of 365.76 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-1,2,2-trifluoroethyl]-N-methylpyridazine-3-sulfonamide.
| Compound Name | N-[1-(4-chlorophenyl)-1,2,2-trifluoroethyl]-N-methylpyridazine-3-sulfonamide |
|---|---|
| PubChem CID | 175581064 |
| Molecular Formula | C13H11ClF3N3O2S |
| Molecular Weight | 365.76 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | N-[1-(4-chlorophenyl)-1,2,2-trifluoroethyl]-N-methylpyridazine-3-sulfonamide |
| SMILES | CN(C(F)(c1ccc(Cl)cc1)C(F)F)S(=O)(=O)c1cccnn1 |
| InChI | InChI=1S/C13H11ClF3N3O2S/c1-20(23(21,22)11-3-2-8-18-19-11)13(17,12(15)16)9-4-6-10(14)7-5-9/h2-8,12H,1H3 |
| InChIKey | RMPIWEQEFZSJDR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.76 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|