About 1-methoxy-3-propylbenzene;molecular hydrogen;N-propan-2-ylbutan-1-amine
1-methoxy-3-propylbenzene;molecular hydrogen;N-propan-2-ylbutan-1-amine (PubChem CID 168900875) has the molecular formula C17H33NO
and a molecular weight of 267.46 g/mol. Its IUPAC name is 1-methoxy-3-propylbenzene;molecular hydrogen;N-propan-2-ylbutan-1-amine.
Molecular Properties
| Compound Name | 1-methoxy-3-propylbenzene;molecular hydrogen;N-propan-2-ylbutan-1-amine |
| PubChem CID | 168900875 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | 1-methoxy-3-propylbenzene;molecular hydrogen;N-propan-2-ylbutan-1-amine |
| SMILES | CCCCNC(C)C.CCCc1cccc(OC)c1.[H][H] |
| InChI | InChI=1S/C10H14O.C7H17N.H2/c1-3-5-9-6-4-7-10(8-9)11-2;1-4-5-6-8-7(2)3;/h4,6-8H,3,5H2,1-2H3;7-8H,4-6H2,1-3H3;1H |
| InChIKey | CWSXABKPABADTH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-3-propylbenzene;molecular hydrogen;N-propan-2-ylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-3-propylbenzene;molecular hydrogen;N-propan-2-ylbutan-1-amine?
The IUPAC name of 1-methoxy-3-propylbenzene;molecular hydrogen;N-propan-2-ylbutan-1-amine (CID 168900875) is 1-methoxy-3-propylbenzene;molecular hydrogen;N-propan-2-ylbutan-1-amine.
What is the SMILES notation for 1-methoxy-3-propylbenzene;molecular hydrogen;N-propan-2-ylbutan-1-amine?
The canonical SMILES for 1-methoxy-3-propylbenzene;molecular hydrogen;N-propan-2-ylbutan-1-amine is CCCCNC(C)C.CCCc1cccc(OC)c1.[H][H].
What is the InChIKey of 1-methoxy-3-propylbenzene;molecular hydrogen;N-propan-2-ylbutan-1-amine?
The InChIKey is CWSXABKPABADTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.C7H17N.H2/c1-3-5-9-6-4-7-10(8-9)11-2;1-4-5-6-8-7(2)3;/h4,6-8H,3,5H2,1-2H3;7-8H,4-6H2,1-3H3;1H.
What are the key properties of 1-methoxy-3-propylbenzene;molecular hydrogen;N-propan-2-ylbutan-1-amine?
1-methoxy-3-propylbenzene;molecular hydrogen;N-propan-2-ylbutan-1-amine has a molecular weight of 267.46 g/mol, XLogP of 4.68, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-3-propylbenzene;molecular hydrogen;N-propan-2-ylbutan-1-amine is sourced from PubChem (CID 168900875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).