C12H20N2O4 — CID 168904504
3-hydroxy-4-[2-[2-(2-methylpropylamino)ethoxy]ethylamino]cyclobut-3-ene-1,2-dione (PubChem CID 168904504) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is 3-hydroxy-4-[2-[2-(2-methylpropylamino)ethoxy]ethylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-hydroxy-4-[2-[2-(2-methylpropylamino)ethoxy]ethylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 168904504 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 3-hydroxy-4-[2-[2-(2-methylpropylamino)ethoxy]ethylamino]cyclobut-3-ene-1,2-dione |
| SMILES | CC(C)CNCCOCCNc1c(O)c(=O)c1=O |
| InChI | InChI=1S/C12H20N2O4/c1-8(2)7-13-3-5-18-6-4-14-9-10(15)12(17)11(9)16/h8,13-15H,3-7H2,1-2H3 |
| InChIKey | MOXBKEFOWSVXNW-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|