C21H21F4N3O — CID 168905538
6-amino-4-[2-fluoro-4-(trifluoromethoxy)phenyl]-3-methyl-2-[methyl(prop-1-ynyl)amino]benzonitrile;ethane (PubChem CID 168905538) has the molecular formula C21H21F4N3O and a molecular weight of 407.41 g/mol. Its IUPAC name is 6-amino-4-[2-fluoro-4-(trifluoromethoxy)phenyl]-3-methyl-2-[methyl(prop-1-ynyl)amino]benzonitrile;ethane.
| Compound Name | 6-amino-4-[2-fluoro-4-(trifluoromethoxy)phenyl]-3-methyl-2-[methyl(prop-1-ynyl)amino]benzonitrile;ethane |
|---|---|
| PubChem CID | 168905538 |
| Molecular Formula | C21H21F4N3O |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 6-amino-4-[2-fluoro-4-(trifluoromethoxy)phenyl]-3-methyl-2-[methyl(prop-1-ynyl)amino]benzonitrile;ethane |
| SMILES | CC.CC#CN(C)c1c(C)c(-c2ccc(OC(F)(F)F)cc2F)cc(N)c1C#N |
| InChI | InChI=1S/C19H15F4N3O.C2H6/c1-4-7-26(3)18-11(2)14(9-17(25)15(18)10-24)13-6-5-12(8-16(13)20)27-19(21,22)23;1-2/h5-6,8-9H,25H2,1-3H3;1-2H3 |
| InChIKey | DKJMGOQBXXLOKX-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|