C22H23F3N2O — CID 168904536
3-(aminomethyl)-N-but-2-ynyl-2-ethenyl-N,6-dimethyl-5-[4-(trifluoromethoxy)phenyl]aniline (PubChem CID 168904536) has the molecular formula C22H23F3N2O and a molecular weight of 388.43 g/mol. Its IUPAC name is 3-(aminomethyl)-N-but-2-ynyl-2-ethenyl-N,6-dimethyl-5-[4-(trifluoromethoxy)phenyl]aniline.
| Compound Name | 3-(aminomethyl)-N-but-2-ynyl-2-ethenyl-N,6-dimethyl-5-[4-(trifluoromethoxy)phenyl]aniline |
|---|---|
| PubChem CID | 168904536 |
| Molecular Formula | C22H23F3N2O |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 3-(aminomethyl)-N-but-2-ynyl-2-ethenyl-N,6-dimethyl-5-[4-(trifluoromethoxy)phenyl]aniline |
| SMILES | C=Cc1c(CN)cc(-c2ccc(OC(F)(F)F)cc2)c(C)c1N(C)CC#CC |
| InChI | InChI=1S/C22H23F3N2O/c1-5-7-12-27(4)21-15(3)20(13-17(14-26)19(21)6-2)16-8-10-18(11-9-16)28-22(23,24)25/h6,8-11,13H,2,12,14,26H2,1,3-4H3 |
| InChIKey | JZGUSLAIBJLQON-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|