C24H20F3NO — CID 18990464
N,N-dimethyl-2-[4-[(E)-2-[4-(1,2,2-trifluoroethenoxy)phenyl]ethenyl]phenyl]aniline (PubChem CID 18990464) has the molecular formula C24H20F3NO and a molecular weight of 395.42 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-[(E)-2-[4-(1,2,2-trifluoroethenoxy)phenyl]ethenyl]phenyl]aniline.
| Compound Name | N,N-dimethyl-2-[4-[(E)-2-[4-(1,2,2-trifluoroethenoxy)phenyl]ethenyl]phenyl]aniline |
|---|---|
| PubChem CID | 18990464 |
| Molecular Formula | C24H20F3NO |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N,N-dimethyl-2-[4-[(E)-2-[4-(1,2,2-trifluoroethenoxy)phenyl]ethenyl]phenyl]aniline |
| SMILES | CN(C)c1ccccc1-c1ccc(/C=C/c2ccc(OC(F)=C(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H20F3NO/c1-28(2)22-6-4-3-5-21(22)19-13-9-17(10-14-19)7-8-18-11-15-20(16-12-18)29-24(27)23(25)26/h3-16H,1-2H3/b8-7+ |
| InChIKey | IKOQQPQDJMFOGM-BQYQJAHWSA-N |
| XLogP | 7.00 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|