C10H23NO — CID 168906567
1,3-dimethylazepan-3-ol;ethane (PubChem CID 168906567) has the molecular formula C10H23NO and a molecular weight of 173.30 g/mol. Its IUPAC name is 1,3-dimethylazepan-3-ol;ethane.
| Compound Name | 1,3-dimethylazepan-3-ol;ethane |
|---|---|
| PubChem CID | 168906567 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | 1,3-dimethylazepan-3-ol;ethane |
| SMILES | CC.CN1CCCCC(C)(O)C1 |
| InChI | InChI=1S/C8H17NO.C2H6/c1-8(10)5-3-4-6-9(2)7-8;1-2/h10H,3-7H2,1-2H3;1-2H3 |
| InChIKey | HRBSZKRBTHKVNI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |