C12H25N3O3 — CID 168906581
2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-ylmethyl N,N-dimethylcarbamate;O-methylhydroxylamine (PubChem CID 168906581) has the molecular formula C12H25N3O3 and a molecular weight of 259.35 g/mol. Its IUPAC name is 2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-ylmethyl N,N-dimethylcarbamate;O-methylhydroxylamine.
| Compound Name | 2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-ylmethyl N,N-dimethylcarbamate;O-methylhydroxylamine |
|---|---|
| PubChem CID | 168906581 |
| Molecular Formula | C12H25N3O3 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-ylmethyl N,N-dimethylcarbamate;O-methylhydroxylamine |
| SMILES | CN(C)C(=O)OCC1CCC2CCCN21.CON |
| InChI | InChI=1S/C11H20N2O2.CH5NO/c1-12(2)11(14)15-8-10-6-5-9-4-3-7-13(9)10;1-3-2/h9-10H,3-8H2,1-2H3;2H2,1H3 |
| InChIKey | CULDFKSENGVYIG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|