C19H28N2O3 — CID 176968102
2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-ylmethyl N-[2-(3,4-dimethylphenoxy)ethyl]carbamate (PubChem CID 176968102) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is 2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-ylmethyl N-[2-(3,4-dimethylphenoxy)ethyl]carbamate.
| Compound Name | 2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-ylmethyl N-[2-(3,4-dimethylphenoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 176968102 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-ylmethyl N-[2-(3,4-dimethylphenoxy)ethyl]carbamate |
| SMILES | Cc1ccc(OCCNC(=O)OCC2CCC3CCCN32)cc1C |
| InChI | InChI=1S/C19H28N2O3/c1-14-5-8-18(12-15(14)2)23-11-9-20-19(22)24-13-17-7-6-16-4-3-10-21(16)17/h5,8,12,16-17H,3-4,6-7,9-11,13H2,1-2H3,(H,20,22) |
| InChIKey | MHLHKVCCBKBNPY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|