C14H20BrNO3 — CID 91579496
2-methylpropyl N-[2-(4-bromo-3-methylphenoxy)ethyl]carbamate (PubChem CID 91579496) has the molecular formula C14H20BrNO3 and a molecular weight of 330.22 g/mol. Its IUPAC name is 2-methylpropyl N-[2-(4-bromo-3-methylphenoxy)ethyl]carbamate.
| Compound Name | 2-methylpropyl N-[2-(4-bromo-3-methylphenoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 91579496 |
| Molecular Formula | C14H20BrNO3 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 2-methylpropyl N-[2-(4-bromo-3-methylphenoxy)ethyl]carbamate |
| SMILES | Cc1cc(OCCNC(=O)OCC(C)C)ccc1Br |
| InChI | InChI=1S/C14H20BrNO3/c1-10(2)9-19-14(17)16-6-7-18-12-4-5-13(15)11(3)8-12/h4-5,8,10H,6-7,9H2,1-3H3,(H,16,17) |
| InChIKey | MRCSJTHEWDTLEP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|