C18H25NO6 — CID 70074586
methyl 5-[2-(2-methylpropoxycarbonylamino)ethoxy]-2-prop-2-enoxybenzoate (PubChem CID 70074586) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is methyl 5-[2-(2-methylpropoxycarbonylamino)ethoxy]-2-prop-2-enoxybenzoate.
| Compound Name | methyl 5-[2-(2-methylpropoxycarbonylamino)ethoxy]-2-prop-2-enoxybenzoate |
|---|---|
| PubChem CID | 70074586 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | methyl 5-[2-(2-methylpropoxycarbonylamino)ethoxy]-2-prop-2-enoxybenzoate |
| SMILES | C=CCOc1ccc(OCCNC(=O)OCC(C)C)cc1C(=O)OC |
| InChI | InChI=1S/C18H25NO6/c1-5-9-24-16-7-6-14(11-15(16)17(20)22-4)23-10-8-19-18(21)25-12-13(2)3/h5-7,11,13H,1,8-10,12H2,2-4H3,(H,19,21) |
| InChIKey | BSNNZSIDKFQXKF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|