C17H22F3N3S — CID 168907178
7-[4-[2-(trifluoromethyl)pyrimidin-4-yl]cyclohexyl]-2-thia-7-azaspiro[3.4]octane (PubChem CID 168907178) has the molecular formula C17H22F3N3S and a molecular weight of 357.45 g/mol. Its IUPAC name is 7-[4-[2-(trifluoromethyl)pyrimidin-4-yl]cyclohexyl]-2-thia-7-azaspiro[3.4]octane.
| Compound Name | 7-[4-[2-(trifluoromethyl)pyrimidin-4-yl]cyclohexyl]-2-thia-7-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 168907178 |
| Molecular Formula | C17H22F3N3S |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 7-[4-[2-(trifluoromethyl)pyrimidin-4-yl]cyclohexyl]-2-thia-7-azaspiro[3.4]octane |
| SMILES | FC(F)(F)c1nccc(C2CCC(N3CCC4(CSC4)C3)CC2)n1 |
| InChI | InChI=1S/C17H22F3N3S/c18-17(19,20)15-21-7-5-14(22-15)12-1-3-13(4-2-12)23-8-6-16(9-23)10-24-11-16/h5,7,12-13H,1-4,6,8-11H2 |
| InChIKey | UJGOQPMPPBZOED-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |