C18H22ClF3N2S — CID 168907336
7-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]cyclohexyl]-2-thia-7-azaspiro[3.4]octane (PubChem CID 168907336) has the molecular formula C18H22ClF3N2S and a molecular weight of 390.90 g/mol. Its IUPAC name is 7-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]cyclohexyl]-2-thia-7-azaspiro[3.4]octane.
| Compound Name | 7-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]cyclohexyl]-2-thia-7-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 168907336 |
| Molecular Formula | C18H22ClF3N2S |
| Molecular Weight | 390.90 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 7-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]cyclohexyl]-2-thia-7-azaspiro[3.4]octane |
| SMILES | FC(F)(F)c1cnc(C2CCC(N3CCC4(CSC4)C3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C18H22ClF3N2S/c19-15-7-13(18(20,21)22)8-23-16(15)12-1-3-14(4-2-12)24-6-5-17(9-24)10-25-11-17/h7-8,12,14H,1-6,9-11H2 |
| InChIKey | BGONXTTYHWBWRY-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.90 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |