C11H17F3N2O — CID 168907508
2-methyl-3-[1-propan-2-yl-3-(trifluoromethyl)pyrazol-5-yl]propan-1-ol (PubChem CID 168907508) has the molecular formula C11H17F3N2O and a molecular weight of 250.26 g/mol. Its IUPAC name is 2-methyl-3-[1-propan-2-yl-3-(trifluoromethyl)pyrazol-5-yl]propan-1-ol.
| Compound Name | 2-methyl-3-[1-propan-2-yl-3-(trifluoromethyl)pyrazol-5-yl]propan-1-ol |
|---|---|
| PubChem CID | 168907508 |
| Molecular Formula | C11H17F3N2O |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 2-methyl-3-[1-propan-2-yl-3-(trifluoromethyl)pyrazol-5-yl]propan-1-ol |
| SMILES | CC(CO)Cc1cc(C(F)(F)F)nn1C(C)C |
| InChI | InChI=1S/C11H17F3N2O/c1-7(2)16-9(4-8(3)6-17)5-10(15-16)11(12,13)14/h5,7-8,17H,4,6H2,1-3H3 |
| InChIKey | XNYXSCMFXUEOQH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |