C15H18F3NO2S — CID 168907519
7-[2-[4-(trifluoromethyl)phenoxy]ethyl]-2λ4-thia-7-azaspiro[3.4]octane 2-oxide (PubChem CID 168907519) has the molecular formula C15H18F3NO2S and a molecular weight of 333.38 g/mol. Its IUPAC name is 7-[2-[4-(trifluoromethyl)phenoxy]ethyl]-2λ4-thia-7-azaspiro[3.4]octane 2-oxide.
| Compound Name | 7-[2-[4-(trifluoromethyl)phenoxy]ethyl]-2λ4-thia-7-azaspiro[3.4]octane 2-oxide |
|---|---|
| PubChem CID | 168907519 |
| Molecular Formula | C15H18F3NO2S |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 7-[2-[4-(trifluoromethyl)phenoxy]ethyl]-2λ4-thia-7-azaspiro[3.4]octane 2-oxide |
| SMILES | O=S1CC2(CCN(CCOc3ccc(C(F)(F)F)cc3)C2)C1 |
| InChI | InChI=1S/C15H18F3NO2S/c16-15(17,18)12-1-3-13(4-2-12)21-8-7-19-6-5-14(9-19)10-22(20)11-14/h1-4H,5-11H2 |
| InChIKey | RVMBIWJSEOXDMY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |