C29H39N7O2S — CID 168910264
N'-[(4S)-4-[(2Z)-2-[amino-[2-[(1,2-dimethylpyrrolidin-2-yl)methoxy]pyrimidin-4-yl]methylidene]pentanoyl]-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 168910264) has the molecular formula C29H39N7O2S and a molecular weight of 549.75 g/mol. Its IUPAC name is N'-[(4S)-4-[(2Z)-2-[amino-[2-[(1,2-dimethylpyrrolidin-2-yl)methoxy]pyrimidin-4-yl]methylidene]pentanoyl]-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[(4S)-4-[(2Z)-2-[amino-[2-[(1,2-dimethylpyrrolidin-2-yl)methoxy]pyrimidin-4-yl]methylidene]pentanoyl]-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 168910264 |
| Molecular Formula | C29H39N7O2S |
| Molecular Weight | 549.75 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | N'-[(4S)-4-[(2Z)-2-[amino-[2-[(1,2-dimethylpyrrolidin-2-yl)methoxy]pyrimidin-4-yl]methylidene]pentanoyl]-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | CCC/C(C(=O)[C@H]1CCCc2sc(/N=C/N(C)C)c(C#N)c21)=C(/N)c1ccnc(OCC2(C)CCCN2C)n1 |
| InChI | InChI=1S/C29H39N7O2S/c1-6-9-20(25(31)22-12-14-32-28(34-22)38-17-29(2)13-8-15-36(29)5)26(37)19-10-7-11-23-24(19)21(16-30)27(39-23)33-18-35(3)4/h12,14,18-19H,6-11,13,15,17,31H2,1-5H3/b25-20-,33-18+/t19-,29?/m0/s1 |
| InChIKey | GUAQGZLVPLZNHY-ZMRTXWTASA-N |
| XLogP | 4.65 |
| TPSA | 120.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.75 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|